About 1,3,5-trifluoro-5-nitrocyclohexa-1,3-diene
1,3,5-trifluoro-5-nitrocyclohexa-1,3-diene (PubChem CID 22100736) has the molecular formula C6H4F3NO2
and a molecular weight of 179.10 g/mol. Its IUPAC name is 1,3,5-trifluoro-5-nitrocyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 1,3,5-trifluoro-5-nitrocyclohexa-1,3-diene |
| PubChem CID | 22100736 |
| Molecular Formula | C6H4F3NO2 |
| Molecular Weight | 179.10 g/mol |
| Exact Mass | 179.02 |
| IUPAC Name | 1,3,5-trifluoro-5-nitrocyclohexa-1,3-diene |
| SMILES | O=[N+]([O-])C1(F)C=C(F)C=C(F)C1 |
| InChI | InChI=1S/C6H4F3NO2/c7-4-1-5(8)3-6(9,2-4)10(11)12/h1-2H,3H2 |
| InChIKey | HPAVKBYRHWOUIR-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.10 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,3,5-trifluoro-5-nitrocyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3,5-trifluoro-5-nitrocyclohexa-1,3-diene?
The IUPAC name of 1,3,5-trifluoro-5-nitrocyclohexa-1,3-diene (CID 22100736) is 1,3,5-trifluoro-5-nitrocyclohexa-1,3-diene.
What is the SMILES notation for 1,3,5-trifluoro-5-nitrocyclohexa-1,3-diene?
The canonical SMILES for 1,3,5-trifluoro-5-nitrocyclohexa-1,3-diene is O=[N+]([O-])C1(F)C=C(F)C=C(F)C1.
What is the InChIKey of 1,3,5-trifluoro-5-nitrocyclohexa-1,3-diene?
The InChIKey is HPAVKBYRHWOUIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4F3NO2/c7-4-1-5(8)3-6(9,2-4)10(11)12/h1-2H,3H2.
What are the key properties of 1,3,5-trifluoro-5-nitrocyclohexa-1,3-diene?
1,3,5-trifluoro-5-nitrocyclohexa-1,3-diene has a molecular weight of 179.10 g/mol, XLogP of 2.04, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,5-trifluoro-5-nitrocyclohexa-1,3-diene is sourced from PubChem (CID 22100736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).