About 4-[[4-(1,3-benzothiazol-2-yl)-3,6-dihydro-2H-pyridin-1-yl]methyl]benzonitrile
4-[[4-(1,3-benzothiazol-2-yl)-3,6-dihydro-2H-pyridin-1-yl]methyl]benzonitrile (PubChem CID 22100953) has the molecular formula C20H17N3S
and a molecular weight of 331.44 g/mol. Its IUPAC name is 4-[[4-(1,3-benzothiazol-2-yl)-3,6-dihydro-2H-pyridin-1-yl]methyl]benzonitrile.
Molecular Properties
| Compound Name | 4-[[4-(1,3-benzothiazol-2-yl)-3,6-dihydro-2H-pyridin-1-yl]methyl]benzonitrile |
| PubChem CID | 22100953 |
| Molecular Formula | C20H17N3S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 4-[[4-(1,3-benzothiazol-2-yl)-3,6-dihydro-2H-pyridin-1-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccc(CN2CC=C(c3nc4ccccc4s3)CC2)cc1 |
| InChI | InChI=1S/C20H17N3S/c21-13-15-5-7-16(8-6-15)14-23-11-9-17(10-12-23)20-22-18-3-1-2-4-19(18)24-20/h1-9H,10-12,14H2 |
| InChIKey | YLMAKJQOMLFYTO-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[[4-(1,3-benzothiazol-2-yl)-3,6-dihydro-2H-pyridin-1-yl]methyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[4-(1,3-benzothiazol-2-yl)-3,6-dihydro-2H-pyridin-1-yl]methyl]benzonitrile?
The IUPAC name of 4-[[4-(1,3-benzothiazol-2-yl)-3,6-dihydro-2H-pyridin-1-yl]methyl]benzonitrile (CID 22100953) is 4-[[4-(1,3-benzothiazol-2-yl)-3,6-dihydro-2H-pyridin-1-yl]methyl]benzonitrile.
What is the SMILES notation for 4-[[4-(1,3-benzothiazol-2-yl)-3,6-dihydro-2H-pyridin-1-yl]methyl]benzonitrile?
The canonical SMILES for 4-[[4-(1,3-benzothiazol-2-yl)-3,6-dihydro-2H-pyridin-1-yl]methyl]benzonitrile is N#Cc1ccc(CN2CC=C(c3nc4ccccc4s3)CC2)cc1.
What is the InChIKey of 4-[[4-(1,3-benzothiazol-2-yl)-3,6-dihydro-2H-pyridin-1-yl]methyl]benzonitrile?
The InChIKey is YLMAKJQOMLFYTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17N3S/c21-13-15-5-7-16(8-6-15)14-23-11-9-17(10-12-23)20-22-18-3-1-2-4-19(18)24-20/h1-9H,10-12,14H2.
What are the key properties of 4-[[4-(1,3-benzothiazol-2-yl)-3,6-dihydro-2H-pyridin-1-yl]methyl]benzonitrile?
4-[[4-(1,3-benzothiazol-2-yl)-3,6-dihydro-2H-pyridin-1-yl]methyl]benzonitrile has a molecular weight of 331.44 g/mol, XLogP of 4.46, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[4-(1,3-benzothiazol-2-yl)-3,6-dihydro-2H-pyridin-1-yl]methyl]benzonitrile is sourced from PubChem (CID 22100953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).