C21H18Cl2N2O4S — CID 22100966
5-chloro-2-[1-[(4-chlorophenyl)methyl]-3,6-dihydro-2H-pyridin-4-yl]-1,3-benzothiazole;oxalic acid (PubChem CID 22100966) has the molecular formula C21H18Cl2N2O4S and a molecular weight of 465.36 g/mol. Its IUPAC name is 5-chloro-2-[1-[(4-chlorophenyl)methyl]-3,6-dihydro-2H-pyridin-4-yl]-1,3-benzothiazole;oxalic acid.
| Compound Name | 5-chloro-2-[1-[(4-chlorophenyl)methyl]-3,6-dihydro-2H-pyridin-4-yl]-1,3-benzothiazole;oxalic acid |
|---|---|
| PubChem CID | 22100966 |
| Molecular Formula | C21H18Cl2N2O4S |
| Molecular Weight | 465.36 g/mol |
| Exact Mass | 464.04 |
| IUPAC Name | 5-chloro-2-[1-[(4-chlorophenyl)methyl]-3,6-dihydro-2H-pyridin-4-yl]-1,3-benzothiazole;oxalic acid |
| SMILES | Clc1ccc(CN2CC=C(c3nc4cc(Cl)ccc4s3)CC2)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H16Cl2N2S.C2H2O4/c20-15-3-1-13(2-4-15)12-23-9-7-14(8-10-23)19-22-17-11-16(21)5-6-18(17)24-19;3-1(4)2(5)6/h1-7,11H,8-10,12H2;(H,3,4)(H,5,6) |
| InChIKey | IIULZDNPCFMPPP-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 90.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.36 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|