About 1-ethyl-3-(4-methoxy-2,3-dihydro-1H-phenalen-2-yl)urea
1-ethyl-3-(4-methoxy-2,3-dihydro-1H-phenalen-2-yl)urea (PubChem CID 22101310) has the molecular formula C17H20N2O2
and a molecular weight of 284.36 g/mol. Its IUPAC name is 1-ethyl-3-(4-methoxy-2,3-dihydro-1H-phenalen-2-yl)urea.
Molecular Properties
| Compound Name | 1-ethyl-3-(4-methoxy-2,3-dihydro-1H-phenalen-2-yl)urea |
| PubChem CID | 22101310 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 1-ethyl-3-(4-methoxy-2,3-dihydro-1H-phenalen-2-yl)urea |
| SMILES | CCNC(=O)NC1Cc2cccc3ccc(OC)c(c23)C1 |
| InChI | InChI=1S/C17H20N2O2/c1-3-18-17(20)19-13-9-12-6-4-5-11-7-8-15(21-2)14(10-13)16(11)12/h4-8,13H,3,9-10H2,1-2H3,(H2,18,19,20) |
| InChIKey | QZKSMIXYUYTBSS-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-ethyl-3-(4-methoxy-2,3-dihydro-1H-phenalen-2-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-(4-methoxy-2,3-dihydro-1H-phenalen-2-yl)urea?
The IUPAC name of 1-ethyl-3-(4-methoxy-2,3-dihydro-1H-phenalen-2-yl)urea (CID 22101310) is 1-ethyl-3-(4-methoxy-2,3-dihydro-1H-phenalen-2-yl)urea.
What is the SMILES notation for 1-ethyl-3-(4-methoxy-2,3-dihydro-1H-phenalen-2-yl)urea?
The canonical SMILES for 1-ethyl-3-(4-methoxy-2,3-dihydro-1H-phenalen-2-yl)urea is CCNC(=O)NC1Cc2cccc3ccc(OC)c(c23)C1.
What is the InChIKey of 1-ethyl-3-(4-methoxy-2,3-dihydro-1H-phenalen-2-yl)urea?
The InChIKey is QZKSMIXYUYTBSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N2O2/c1-3-18-17(20)19-13-9-12-6-4-5-11-7-8-15(21-2)14(10-13)16(11)12/h4-8,13H,3,9-10H2,1-2H3,(H2,18,19,20).
What are the key properties of 1-ethyl-3-(4-methoxy-2,3-dihydro-1H-phenalen-2-yl)urea?
1-ethyl-3-(4-methoxy-2,3-dihydro-1H-phenalen-2-yl)urea has a molecular weight of 284.36 g/mol, XLogP of 2.63, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-(4-methoxy-2,3-dihydro-1H-phenalen-2-yl)urea is sourced from PubChem (CID 22101310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).