C10H6F6O4S — CID 22101359
4-fluoro-5-methylsulfonyl-2-(1,1,2,2,2-pentafluoroethyl)benzoic acid (PubChem CID 22101359) has the molecular formula C10H6F6O4S and a molecular weight of 336.21 g/mol. Its IUPAC name is 4-fluoro-5-methylsulfonyl-2-(1,1,2,2,2-pentafluoroethyl)benzoic acid.
| Compound Name | 4-fluoro-5-methylsulfonyl-2-(1,1,2,2,2-pentafluoroethyl)benzoic acid |
|---|---|
| PubChem CID | 22101359 |
| Molecular Formula | C10H6F6O4S |
| Molecular Weight | 336.21 g/mol |
| Exact Mass | 335.99 |
| IUPAC Name | 4-fluoro-5-methylsulfonyl-2-(1,1,2,2,2-pentafluoroethyl)benzoic acid |
| SMILES | CS(=O)(=O)c1cc(C(=O)O)c(C(F)(F)C(F)(F)F)cc1F |
| InChI | InChI=1S/C10H6F6O4S/c1-21(19,20)7-2-4(8(17)18)5(3-6(7)11)9(12,13)10(14,15)16/h2-3H,1H3,(H,17,18) |
| InChIKey | MQZYNMPGZNHAMT-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.21 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|