About 2-amino-4,7,7-trimethylcyclohept-3-en-1-one
2-amino-4,7,7-trimethylcyclohept-3-en-1-one (PubChem CID 22101535) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is 2-amino-4,7,7-trimethylcyclohept-3-en-1-one.
Molecular Properties
| Compound Name | 2-amino-4,7,7-trimethylcyclohept-3-en-1-one |
| PubChem CID | 22101535 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 2-amino-4,7,7-trimethylcyclohept-3-en-1-one |
| SMILES | CC1=CC(N)C(=O)C(C)(C)CC1 |
| InChI | InChI=1S/C10H17NO/c1-7-4-5-10(2,3)9(12)8(11)6-7/h6,8H,4-5,11H2,1-3H3 |
| InChIKey | PGABCUKNYZGWBM-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-4,7,7-trimethylcyclohept-3-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4,7,7-trimethylcyclohept-3-en-1-one?
The IUPAC name of 2-amino-4,7,7-trimethylcyclohept-3-en-1-one (CID 22101535) is 2-amino-4,7,7-trimethylcyclohept-3-en-1-one.
What is the SMILES notation for 2-amino-4,7,7-trimethylcyclohept-3-en-1-one?
The canonical SMILES for 2-amino-4,7,7-trimethylcyclohept-3-en-1-one is CC1=CC(N)C(=O)C(C)(C)CC1.
What is the InChIKey of 2-amino-4,7,7-trimethylcyclohept-3-en-1-one?
The InChIKey is PGABCUKNYZGWBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO/c1-7-4-5-10(2,3)9(12)8(11)6-7/h6,8H,4-5,11H2,1-3H3.
What are the key properties of 2-amino-4,7,7-trimethylcyclohept-3-en-1-one?
2-amino-4,7,7-trimethylcyclohept-3-en-1-one has a molecular weight of 167.25 g/mol, XLogP of 1.65, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4,7,7-trimethylcyclohept-3-en-1-one is sourced from PubChem (CID 22101535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).