C16H24N2O4 — CID 22101609
2-[6-(4,4-dimethyl-5-oxo-1,3-oxazol-2-yl)hexyl]-4,4-dimethyl-1,3-oxazol-5-one (PubChem CID 22101609) has the molecular formula C16H24N2O4 and a molecular weight of 308.38 g/mol. Its IUPAC name is 2-[6-(4,4-dimethyl-5-oxo-1,3-oxazol-2-yl)hexyl]-4,4-dimethyl-1,3-oxazol-5-one.
| Compound Name | 2-[6-(4,4-dimethyl-5-oxo-1,3-oxazol-2-yl)hexyl]-4,4-dimethyl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 22101609 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 2-[6-(4,4-dimethyl-5-oxo-1,3-oxazol-2-yl)hexyl]-4,4-dimethyl-1,3-oxazol-5-one |
| SMILES | CC1(C)N=C(CCCCCCC2=NC(C)(C)C(=O)O2)OC1=O |
| InChI | InChI=1S/C16H24N2O4/c1-15(2)13(19)21-11(17-15)9-7-5-6-8-10-12-18-16(3,4)14(20)22-12/h5-10H2,1-4H3 |
| InChIKey | QYDLRLMAAAQEJO-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|