C12H10F3NOS — CID 22101830
(4-methyl-1,3-thiazol-5-yl)-(2,4,5-trifluoro-3-methylphenyl)methanol (PubChem CID 22101830) has the molecular formula C12H10F3NOS and a molecular weight of 273.28 g/mol. Its IUPAC name is (4-methyl-1,3-thiazol-5-yl)-(2,4,5-trifluoro-3-methylphenyl)methanol.
| Compound Name | (4-methyl-1,3-thiazol-5-yl)-(2,4,5-trifluoro-3-methylphenyl)methanol |
|---|---|
| PubChem CID | 22101830 |
| Molecular Formula | C12H10F3NOS |
| Molecular Weight | 273.28 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | (4-methyl-1,3-thiazol-5-yl)-(2,4,5-trifluoro-3-methylphenyl)methanol |
| SMILES | Cc1ncsc1C(O)c1cc(F)c(F)c(C)c1F |
| InChI | InChI=1S/C12H10F3NOS/c1-5-9(14)7(3-8(13)10(5)15)11(17)12-6(2)16-4-18-12/h3-4,11,17H,1-2H3 |
| InChIKey | VWWDKZDXJVYGFL-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.28 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|