About 2-(6,6-dimethoxyhexyl)oxirane
2-(6,6-dimethoxyhexyl)oxirane (PubChem CID 22101928) has the molecular formula C10H20O3
and a molecular weight of 188.27 g/mol. Its IUPAC name is 2-(6,6-dimethoxyhexyl)oxirane.
Molecular Properties
| Compound Name | 2-(6,6-dimethoxyhexyl)oxirane |
| PubChem CID | 22101928 |
| Molecular Formula | C10H20O3 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.14 |
| IUPAC Name | 2-(6,6-dimethoxyhexyl)oxirane |
| SMILES | COC(CCCCCC1CO1)OC |
| InChI | InChI=1S/C10H20O3/c1-11-10(12-2)7-5-3-4-6-9-8-13-9/h9-10H,3-8H2,1-2H3 |
| InChIKey | DKGZXKTVWBNBDN-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-(6,6-dimethoxyhexyl)oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6,6-dimethoxyhexyl)oxirane?
The IUPAC name of 2-(6,6-dimethoxyhexyl)oxirane (CID 22101928) is 2-(6,6-dimethoxyhexyl)oxirane.
What is the SMILES notation for 2-(6,6-dimethoxyhexyl)oxirane?
The canonical SMILES for 2-(6,6-dimethoxyhexyl)oxirane is COC(CCCCCC1CO1)OC.
What is the InChIKey of 2-(6,6-dimethoxyhexyl)oxirane?
The InChIKey is DKGZXKTVWBNBDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O3/c1-11-10(12-2)7-5-3-4-6-9-8-13-9/h9-10H,3-8H2,1-2H3.
What are the key properties of 2-(6,6-dimethoxyhexyl)oxirane?
2-(6,6-dimethoxyhexyl)oxirane has a molecular weight of 188.27 g/mol, XLogP of 1.95, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6,6-dimethoxyhexyl)oxirane is sourced from PubChem (CID 22101928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).