C19H16F2O6S — CID 22101944
(Z)-4-acetyloxy-2-(3,4-difluorophenyl)-3-(4-methylsulfonylphenyl)but-2-enoic acid (PubChem CID 22101944) has the molecular formula C19H16F2O6S and a molecular weight of 410.39 g/mol. Its IUPAC name is (Z)-4-acetyloxy-2-(3,4-difluorophenyl)-3-(4-methylsulfonylphenyl)but-2-enoic acid.
| Compound Name | (Z)-4-acetyloxy-2-(3,4-difluorophenyl)-3-(4-methylsulfonylphenyl)but-2-enoic acid |
|---|---|
| PubChem CID | 22101944 |
| Molecular Formula | C19H16F2O6S |
| Molecular Weight | 410.39 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | (Z)-4-acetyloxy-2-(3,4-difluorophenyl)-3-(4-methylsulfonylphenyl)but-2-enoic acid |
| SMILES | CC(=O)OC/C(=C(\C(=O)O)c1ccc(F)c(F)c1)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C19H16F2O6S/c1-11(22)27-10-15(12-3-6-14(7-4-12)28(2,25)26)18(19(23)24)13-5-8-16(20)17(21)9-13/h3-9H,10H2,1-2H3,(H,23,24)/b18-15+ |
| InChIKey | UNQOYSVHZPCNGH-OBGWFSINSA-N |
| XLogP | 2.93 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.39 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|