C30H25N9O5 — CID 22102660
4-cyano-2-[[2-[3-(diaminomethylideneamino)phenoxy]-7-(2,3-dihydro-1H-indol-3-ylmethyl)-6-oxo-7,8-dihydro-5H-pteridin-4-yl]oxy]benzoic acid (PubChem CID 22102660) has the molecular formula C30H25N9O5 and a molecular weight of 591.59 g/mol. Its IUPAC name is 4-cyano-2-[[2-[3-(diaminomethylideneamino)phenoxy]-7-(2,3-dihydro-1H-indol-3-ylmethyl)-6-oxo-7,8-dihydro-5H-pteridin-4-yl]oxy]benzoic acid.
| Compound Name | 4-cyano-2-[[2-[3-(diaminomethylideneamino)phenoxy]-7-(2,3-dihydro-1H-indol-3-ylmethyl)-6-oxo-7,8-dihydro-5H-pteridin-4-yl]oxy]benzoic acid |
|---|---|
| PubChem CID | 22102660 |
| Molecular Formula | C30H25N9O5 |
| Molecular Weight | 591.59 g/mol |
| Exact Mass | 591.20 |
| IUPAC Name | 4-cyano-2-[[2-[3-(diaminomethylideneamino)phenoxy]-7-(2,3-dihydro-1H-indol-3-ylmethyl)-6-oxo-7,8-dihydro-5H-pteridin-4-yl]oxy]benzoic acid |
| SMILES | N#Cc1ccc(C(=O)O)c(Oc2nc(Oc3cccc(N=C(N)N)c3)nc3c2NC(=O)C(CC2CNc4ccccc42)N3)c1 |
| InChI | InChI=1S/C30H25N9O5/c31-13-15-8-9-20(28(41)42)23(10-15)44-27-24-25(38-30(39-27)43-18-5-3-4-17(12-18)35-29(32)33)36-22(26(40)37-24)11-16-14-34-21-7-2-1-6-19(16)21/h1-10,12,16,22,34H,11,14H2,(H,37,40)(H,41,42)(H4,32,33,35)(H,36,38,39) |
| InChIKey | QPVCDLRQCNZLJK-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 222.89 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.59 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|