C26H33N11O3 — CID 22102973
3-[[7-(4-aminobutyl)-2-[3-(diaminomethylideneamino)phenoxy]-6-oxo-7,8-dihydro-5H-pteridin-4-yl]oxy]-4-(dimethylamino)benzenecarboximidamide (PubChem CID 22102973) has the molecular formula C26H33N11O3 and a molecular weight of 547.62 g/mol. Its IUPAC name is 3-[[7-(4-aminobutyl)-2-[3-(diaminomethylideneamino)phenoxy]-6-oxo-7,8-dihydro-5H-pteridin-4-yl]oxy]-4-(dimethylamino)benzenecarboximidamide.
| Compound Name | 3-[[7-(4-aminobutyl)-2-[3-(diaminomethylideneamino)phenoxy]-6-oxo-7,8-dihydro-5H-pteridin-4-yl]oxy]-4-(dimethylamino)benzenecarboximidamide |
|---|---|
| PubChem CID | 22102973 |
| Molecular Formula | C26H33N11O3 |
| Molecular Weight | 547.62 g/mol |
| Exact Mass | 547.28 |
| IUPAC Name | 3-[[7-(4-aminobutyl)-2-[3-(diaminomethylideneamino)phenoxy]-6-oxo-7,8-dihydro-5H-pteridin-4-yl]oxy]-4-(dimethylamino)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(N(C)C)c(Oc2nc(Oc3cccc(N=C(N)N)c3)nc3c2NC(=O)C(CCCCN)N3)c1 |
| InChI | InChI=1S/C26H33N11O3/c1-37(2)18-10-9-14(21(28)29)12-19(18)40-24-20-22(33-17(23(38)34-20)8-3-4-11-27)35-26(36-24)39-16-7-5-6-15(13-16)32-25(30)31/h5-7,9-10,12-13,17H,3-4,8,11,27H2,1-2H3,(H3,28,29)(H,34,38)(H4,30,31,32)(H,33,35,36) |
| InChIKey | BMYYWNACULMMKO-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 228.90 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.62 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|