C23H24N4O6S — CID 22103387
N-(3,4-dimethyl-1,2-oxazol-5-yl)-N-(2-methoxyethoxymethyl)-2-[4-(1,3,4-oxadiazol-2-yl)phenyl]benzenesulfonamide (PubChem CID 22103387) has the molecular formula C23H24N4O6S and a molecular weight of 484.53 g/mol. Its IUPAC name is N-(3,4-dimethyl-1,2-oxazol-5-yl)-N-(2-methoxyethoxymethyl)-2-[4-(1,3,4-oxadiazol-2-yl)phenyl]benzenesulfonamide.
| Compound Name | N-(3,4-dimethyl-1,2-oxazol-5-yl)-N-(2-methoxyethoxymethyl)-2-[4-(1,3,4-oxadiazol-2-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 22103387 |
| Molecular Formula | C23H24N4O6S |
| Molecular Weight | 484.53 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | N-(3,4-dimethyl-1,2-oxazol-5-yl)-N-(2-methoxyethoxymethyl)-2-[4-(1,3,4-oxadiazol-2-yl)phenyl]benzenesulfonamide |
| SMILES | COCCOCN(c1onc(C)c1C)S(=O)(=O)c1ccccc1-c1ccc(-c2nnco2)cc1 |
| InChI | InChI=1S/C23H24N4O6S/c1-16-17(2)26-33-23(16)27(15-31-13-12-30-3)34(28,29)21-7-5-4-6-20(21)18-8-10-19(11-9-18)22-25-24-14-32-22/h4-11,14H,12-13,15H2,1-3H3 |
| InChIKey | QXAHYXVCBGZKQF-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 120.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.53 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|