C17H21N7O3 — CID 22103391
methyl 1-[3-[2,6-dimethyl-4-(2-methyltetrazol-5-yl)phenoxy]propyl]-1,2,4-triazole-3-carboxylate (PubChem CID 22103391) has the molecular formula C17H21N7O3 and a molecular weight of 371.40 g/mol. Its IUPAC name is methyl 1-[3-[2,6-dimethyl-4-(2-methyltetrazol-5-yl)phenoxy]propyl]-1,2,4-triazole-3-carboxylate.
| Compound Name | methyl 1-[3-[2,6-dimethyl-4-(2-methyltetrazol-5-yl)phenoxy]propyl]-1,2,4-triazole-3-carboxylate |
|---|---|
| PubChem CID | 22103391 |
| Molecular Formula | C17H21N7O3 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | methyl 1-[3-[2,6-dimethyl-4-(2-methyltetrazol-5-yl)phenoxy]propyl]-1,2,4-triazole-3-carboxylate |
| SMILES | COC(=O)c1ncn(CCCOc2c(C)cc(-c3nnn(C)n3)cc2C)n1 |
| InChI | InChI=1S/C17H21N7O3/c1-11-8-13(15-19-22-23(3)20-15)9-12(2)14(11)27-7-5-6-24-10-18-16(21-24)17(25)26-4/h8-10H,5-7H2,1-4H3 |
| InChIKey | AIGMTJYZEZKMFK-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 109.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|