C32H31N5O6S — CID 22103488
2-[2-(benzimidazol-1-ylmethyl)-4-(1,3-oxazol-2-yl)phenyl]-N-(3,4-dimethyl-1,2-oxazol-5-yl)-N-(2-methoxyethoxymethyl)benzenesulfonamide (PubChem CID 22103488) has the molecular formula C32H31N5O6S and a molecular weight of 613.70 g/mol. Its IUPAC name is 2-[2-(benzimidazol-1-ylmethyl)-4-(1,3-oxazol-2-yl)phenyl]-N-(3,4-dimethyl-1,2-oxazol-5-yl)-N-(2-methoxyethoxymethyl)benzenesulfonamide.
| Compound Name | 2-[2-(benzimidazol-1-ylmethyl)-4-(1,3-oxazol-2-yl)phenyl]-N-(3,4-dimethyl-1,2-oxazol-5-yl)-N-(2-methoxyethoxymethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 22103488 |
| Molecular Formula | C32H31N5O6S |
| Molecular Weight | 613.70 g/mol |
| Exact Mass | 613.20 |
| IUPAC Name | 2-[2-(benzimidazol-1-ylmethyl)-4-(1,3-oxazol-2-yl)phenyl]-N-(3,4-dimethyl-1,2-oxazol-5-yl)-N-(2-methoxyethoxymethyl)benzenesulfonamide |
| SMILES | COCCOCN(c1onc(C)c1C)S(=O)(=O)c1ccccc1-c1ccc(-c2ncco2)cc1Cn1cnc2ccccc21 |
| InChI | InChI=1S/C32H31N5O6S/c1-22-23(2)35-43-32(22)37(21-41-17-16-40-3)44(38,39)30-11-7-4-8-27(30)26-13-12-24(31-33-14-15-42-31)18-25(26)19-36-20-34-28-9-5-6-10-29(28)36/h4-15,18,20H,16-17,19,21H2,1-3H3 |
| InChIKey | PKMCIWHHDUNKKH-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 125.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.70 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|