C33H37N5O6S — CID 22103516
2-[2-[(2-anilinoethylamino)methyl]-4-(1,3-oxazol-2-yl)phenyl]-N-(3,4-dimethyl-1,2-oxazol-5-yl)-N-(2-methoxyethoxymethyl)benzenesulfonamide (PubChem CID 22103516) has the molecular formula C33H37N5O6S and a molecular weight of 631.76 g/mol. Its IUPAC name is 2-[2-[(2-anilinoethylamino)methyl]-4-(1,3-oxazol-2-yl)phenyl]-N-(3,4-dimethyl-1,2-oxazol-5-yl)-N-(2-methoxyethoxymethyl)benzenesulfonamide.
| Compound Name | 2-[2-[(2-anilinoethylamino)methyl]-4-(1,3-oxazol-2-yl)phenyl]-N-(3,4-dimethyl-1,2-oxazol-5-yl)-N-(2-methoxyethoxymethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 22103516 |
| Molecular Formula | C33H37N5O6S |
| Molecular Weight | 631.76 g/mol |
| Exact Mass | 631.25 |
| IUPAC Name | 2-[2-[(2-anilinoethylamino)methyl]-4-(1,3-oxazol-2-yl)phenyl]-N-(3,4-dimethyl-1,2-oxazol-5-yl)-N-(2-methoxyethoxymethyl)benzenesulfonamide |
| SMILES | COCCOCN(c1onc(C)c1C)S(=O)(=O)c1ccccc1-c1ccc(-c2ncco2)cc1CNCCNc1ccccc1 |
| InChI | InChI=1S/C33H37N5O6S/c1-24-25(2)37-44-33(24)38(23-42-20-19-41-3)45(39,40)31-12-8-7-11-30(31)29-14-13-26(32-36-17-18-43-32)21-27(29)22-34-15-16-35-28-9-5-4-6-10-28/h4-14,17-18,21,34-35H,15-16,19-20,22-23H2,1-3H3 |
| InChIKey | NRJPUXPAMASOKD-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 131.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.76 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|