About N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-[4-(1-methylimidazol-2-yl)phenyl]benzenesulfonamide
N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-[4-(1-methylimidazol-2-yl)phenyl]benzenesulfonamide (PubChem CID 22103797) has the molecular formula C21H20N4O3S
and a molecular weight of 408.48 g/mol. Its IUPAC name is N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-[4-(1-methylimidazol-2-yl)phenyl]benzenesulfonamide.
Molecular Properties
| Compound Name | N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-[4-(1-methylimidazol-2-yl)phenyl]benzenesulfonamide |
| PubChem CID | 22103797 |
| Molecular Formula | C21H20N4O3S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-[4-(1-methylimidazol-2-yl)phenyl]benzenesulfonamide |
| SMILES | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3nccn3C)cc2)c1C |
| InChI | InChI=1S/C21H20N4O3S/c1-14-15(2)23-28-21(14)24-29(26,27)19-7-5-4-6-18(19)16-8-10-17(11-9-16)20-22-12-13-25(20)3/h4-13,24H,1-3H3 |
| InChIKey | SMFAJSYEZREKBY-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 90.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-[4-(1-methylimidazol-2-yl)phenyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-[4-(1-methylimidazol-2-yl)phenyl]benzenesulfonamide?
The IUPAC name of N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-[4-(1-methylimidazol-2-yl)phenyl]benzenesulfonamide (CID 22103797) is N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-[4-(1-methylimidazol-2-yl)phenyl]benzenesulfonamide.
What is the SMILES notation for N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-[4-(1-methylimidazol-2-yl)phenyl]benzenesulfonamide?
The canonical SMILES for N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-[4-(1-methylimidazol-2-yl)phenyl]benzenesulfonamide is Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3nccn3C)cc2)c1C.
What is the InChIKey of N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-[4-(1-methylimidazol-2-yl)phenyl]benzenesulfonamide?
The InChIKey is SMFAJSYEZREKBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N4O3S/c1-14-15(2)23-28-21(14)24-29(26,27)19-7-5-4-6-18(19)16-8-10-17(11-9-16)20-22-12-13-25(20)3/h4-13,24H,1-3H3.
What are the key properties of N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-[4-(1-methylimidazol-2-yl)phenyl]benzenesulfonamide?
N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-[4-(1-methylimidazol-2-yl)phenyl]benzenesulfonamide has a molecular weight of 408.48 g/mol, XLogP of 4.16, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-[4-(1-methylimidazol-2-yl)phenyl]benzenesulfonamide is sourced from PubChem (CID 22103797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).