C17H18N4O5S — CID 2210483
1-(3,5-dimethoxyphenyl)-3-[[2-(2-nitrophenyl)acetyl]amino]thiourea (PubChem CID 2210483) has the molecular formula C17H18N4O5S and a molecular weight of 390.42 g/mol. Its IUPAC name is 1-(3,5-dimethoxyphenyl)-3-[[2-(2-nitrophenyl)acetyl]amino]thiourea.
| Compound Name | 1-(3,5-dimethoxyphenyl)-3-[[2-(2-nitrophenyl)acetyl]amino]thiourea |
|---|---|
| PubChem CID | 2210483 |
| Molecular Formula | C17H18N4O5S |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | 1-(3,5-dimethoxyphenyl)-3-[[2-(2-nitrophenyl)acetyl]amino]thiourea |
| SMILES | COc1cc(NC(=S)NNC(=O)Cc2ccccc2[N+](=O)[O-])cc(OC)c1 |
| InChI | InChI=1S/C17H18N4O5S/c1-25-13-8-12(9-14(10-13)26-2)18-17(27)20-19-16(22)7-11-5-3-4-6-15(11)21(23)24/h3-6,8-10H,7H2,1-2H3,(H,19,22)(H2,18,20,27) |
| InChIKey | DVLMPOMWDZPNCJ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 114.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|