About 4,4a-dimethyl-6-prop-1-en-2-ylnaphtho[1,8a-b]oxirene
4,4a-dimethyl-6-prop-1-en-2-ylnaphtho[1,8a-b]oxirene (PubChem CID 22104939) has the molecular formula C15H16O
and a molecular weight of 212.29 g/mol. Its IUPAC name is 4,4a-dimethyl-6-prop-1-en-2-ylnaphtho[1,8a-b]oxirene.
Molecular Properties
| Compound Name | 4,4a-dimethyl-6-prop-1-en-2-ylnaphtho[1,8a-b]oxirene |
| PubChem CID | 22104939 |
| Molecular Formula | C15H16O |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 4,4a-dimethyl-6-prop-1-en-2-ylnaphtho[1,8a-b]oxirene |
| SMILES | C=C(C)C1=CC2(C)C(C)=CC=C3OC32C=C1 |
| InChI | InChI=1S/C15H16O/c1-10(2)12-7-8-15-13(16-15)6-5-11(3)14(15,4)9-12/h5-9H,1H2,2-4H3 |
| InChIKey | WSVVXNPATTUCAA-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 4,4a-dimethyl-6-prop-1-en-2-ylnaphtho[1,8a-b]oxirene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4a-dimethyl-6-prop-1-en-2-ylnaphtho[1,8a-b]oxirene?
The IUPAC name of 4,4a-dimethyl-6-prop-1-en-2-ylnaphtho[1,8a-b]oxirene (CID 22104939) is 4,4a-dimethyl-6-prop-1-en-2-ylnaphtho[1,8a-b]oxirene.
What is the SMILES notation for 4,4a-dimethyl-6-prop-1-en-2-ylnaphtho[1,8a-b]oxirene?
The canonical SMILES for 4,4a-dimethyl-6-prop-1-en-2-ylnaphtho[1,8a-b]oxirene is C=C(C)C1=CC2(C)C(C)=CC=C3OC32C=C1.
What is the InChIKey of 4,4a-dimethyl-6-prop-1-en-2-ylnaphtho[1,8a-b]oxirene?
The InChIKey is WSVVXNPATTUCAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16O/c1-10(2)12-7-8-15-13(16-15)6-5-11(3)14(15,4)9-12/h5-9H,1H2,2-4H3.
What are the key properties of 4,4a-dimethyl-6-prop-1-en-2-ylnaphtho[1,8a-b]oxirene?
4,4a-dimethyl-6-prop-1-en-2-ylnaphtho[1,8a-b]oxirene has a molecular weight of 212.29 g/mol, XLogP of 3.68, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4a-dimethyl-6-prop-1-en-2-ylnaphtho[1,8a-b]oxirene is sourced from PubChem (CID 22104939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).