About 6-methoxy-4,6-dinitrocyclohexa-2,4-dien-1-ol
6-methoxy-4,6-dinitrocyclohexa-2,4-dien-1-ol (PubChem CID 22104948) has the molecular formula C7H8N2O6
and a molecular weight of 216.15 g/mol. Its IUPAC name is 6-methoxy-4,6-dinitrocyclohexa-2,4-dien-1-ol.
Molecular Properties
| Compound Name | 6-methoxy-4,6-dinitrocyclohexa-2,4-dien-1-ol |
| PubChem CID | 22104948 |
| Molecular Formula | C7H8N2O6 |
| Molecular Weight | 216.15 g/mol |
| Exact Mass | 216.04 |
| IUPAC Name | 6-methoxy-4,6-dinitrocyclohexa-2,4-dien-1-ol |
| SMILES | COC1([N+](=O)[O-])C=C([N+](=O)[O-])C=CC1O |
| InChI | InChI=1S/C7H8N2O6/c1-15-7(9(13)14)4-5(8(11)12)2-3-6(7)10/h2-4,6,10H,1H3 |
| InChIKey | MNZGJYCJXAHVCB-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 115.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.15 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-methoxy-4,6-dinitrocyclohexa-2,4-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-4,6-dinitrocyclohexa-2,4-dien-1-ol?
The IUPAC name of 6-methoxy-4,6-dinitrocyclohexa-2,4-dien-1-ol (CID 22104948) is 6-methoxy-4,6-dinitrocyclohexa-2,4-dien-1-ol.
What is the SMILES notation for 6-methoxy-4,6-dinitrocyclohexa-2,4-dien-1-ol?
The canonical SMILES for 6-methoxy-4,6-dinitrocyclohexa-2,4-dien-1-ol is COC1([N+](=O)[O-])C=C([N+](=O)[O-])C=CC1O.
What is the InChIKey of 6-methoxy-4,6-dinitrocyclohexa-2,4-dien-1-ol?
The InChIKey is MNZGJYCJXAHVCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O6/c1-15-7(9(13)14)4-5(8(11)12)2-3-6(7)10/h2-4,6,10H,1H3.
What are the key properties of 6-methoxy-4,6-dinitrocyclohexa-2,4-dien-1-ol?
6-methoxy-4,6-dinitrocyclohexa-2,4-dien-1-ol has a molecular weight of 216.15 g/mol, XLogP of -0.30, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-4,6-dinitrocyclohexa-2,4-dien-1-ol is sourced from PubChem (CID 22104948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).