C14H20O9 — CID 22105010
2-hydroxy-5-(oxiran-2-yl)-3-[2-(oxiran-2-yl)ethyl]pentane-1,2,3-tricarboxylic acid (PubChem CID 22105010) has the molecular formula C14H20O9 and a molecular weight of 332.31 g/mol. Its IUPAC name is 2-hydroxy-5-(oxiran-2-yl)-3-[2-(oxiran-2-yl)ethyl]pentane-1,2,3-tricarboxylic acid.
| Compound Name | 2-hydroxy-5-(oxiran-2-yl)-3-[2-(oxiran-2-yl)ethyl]pentane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 22105010 |
| Molecular Formula | C14H20O9 |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 2-hydroxy-5-(oxiran-2-yl)-3-[2-(oxiran-2-yl)ethyl]pentane-1,2,3-tricarboxylic acid |
| SMILES | O=C(O)CC(O)(C(=O)O)C(CCC1CO1)(CCC1CO1)C(=O)O |
| InChI | InChI=1S/C14H20O9/c15-10(16)5-14(21,12(19)20)13(11(17)18,3-1-8-6-22-8)4-2-9-7-23-9/h8-9,21H,1-7H2,(H,15,16)(H,17,18)(H,19,20) |
| InChIKey | CRMRSUCAFMTESV-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 157.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|