About ethylaminothiourea
ethylaminothiourea (PubChem CID 22105028) has the molecular formula C3H9N3S
and a molecular weight of 119.19 g/mol. Its IUPAC name is ethylaminothiourea.
Molecular Properties
| Compound Name | ethylaminothiourea |
| PubChem CID | 22105028 |
| Molecular Formula | C3H9N3S |
| Molecular Weight | 119.19 g/mol |
| Exact Mass | 119.05 |
| IUPAC Name | ethylaminothiourea |
| SMILES | CCNNC(N)=S |
| InChI | InChI=1S/C3H9N3S/c1-2-5-6-3(4)7/h5H,2H2,1H3,(H3,4,6,7) |
| InChIKey | IDAYARXLWPWWNI-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.19 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze ethylaminothiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethylaminothiourea?
The IUPAC name of ethylaminothiourea (CID 22105028) is ethylaminothiourea.
What is the SMILES notation for ethylaminothiourea?
The canonical SMILES for ethylaminothiourea is CCNNC(N)=S.
What is the InChIKey of ethylaminothiourea?
The InChIKey is IDAYARXLWPWWNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N3S/c1-2-5-6-3(4)7/h5H,2H2,1H3,(H3,4,6,7).
What are the key properties of ethylaminothiourea?
ethylaminothiourea has a molecular weight of 119.19 g/mol, XLogP of -0.66, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethylaminothiourea is sourced from PubChem (CID 22105028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).