About 4-bromophenol;4-chlorophenol
4-bromophenol;4-chlorophenol (PubChem CID 22105166) has the molecular formula C12H10BrClO2
and a molecular weight of 301.57 g/mol. Its IUPAC name is 4-bromophenol;4-chlorophenol.
Molecular Properties
| Compound Name | 4-bromophenol;4-chlorophenol |
| PubChem CID | 22105166 |
| Molecular Formula | C12H10BrClO2 |
| Molecular Weight | 301.57 g/mol |
| Exact Mass | 299.96 |
| IUPAC Name | 4-bromophenol;4-chlorophenol |
| SMILES | Oc1ccc(Br)cc1.Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C6H5BrO.C6H5ClO/c2*7-5-1-3-6(8)4-2-5/h2*1-4,8H |
| InChIKey | OTRIEQYKGMHSOL-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.57 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-bromophenol;4-chlorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromophenol;4-chlorophenol?
The IUPAC name of 4-bromophenol;4-chlorophenol (CID 22105166) is 4-bromophenol;4-chlorophenol.
What is the SMILES notation for 4-bromophenol;4-chlorophenol?
The canonical SMILES for 4-bromophenol;4-chlorophenol is Oc1ccc(Br)cc1.Oc1ccc(Cl)cc1.
What is the InChIKey of 4-bromophenol;4-chlorophenol?
The InChIKey is OTRIEQYKGMHSOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5BrO.C6H5ClO/c2*7-5-1-3-6(8)4-2-5/h2*1-4,8H.
What are the key properties of 4-bromophenol;4-chlorophenol?
4-bromophenol;4-chlorophenol has a molecular weight of 301.57 g/mol, XLogP of 4.20, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromophenol;4-chlorophenol is sourced from PubChem (CID 22105166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).