C22H20BrN3O — CID 22105645
6-[(5-bromo-2-phenylmethoxyphenyl)methyl-ethylamino]pyridine-3-carbonitrile (PubChem CID 22105645) has the molecular formula C22H20BrN3O and a molecular weight of 422.33 g/mol. Its IUPAC name is 6-[(5-bromo-2-phenylmethoxyphenyl)methyl-ethylamino]pyridine-3-carbonitrile.
| Compound Name | 6-[(5-bromo-2-phenylmethoxyphenyl)methyl-ethylamino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 22105645 |
| Molecular Formula | C22H20BrN3O |
| Molecular Weight | 422.33 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | 6-[(5-bromo-2-phenylmethoxyphenyl)methyl-ethylamino]pyridine-3-carbonitrile |
| SMILES | CCN(Cc1cc(Br)ccc1OCc1ccccc1)c1ccc(C#N)cn1 |
| InChI | InChI=1S/C22H20BrN3O/c1-2-26(22-11-8-18(13-24)14-25-22)15-19-12-20(23)9-10-21(19)27-16-17-6-4-3-5-7-17/h3-12,14H,2,15-16H2,1H3 |
| InChIKey | FKBZDVIISQDTCM-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 49.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.33 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |