C35H45N5O3 — CID 22105929
1-[1-butyl-4-[3-[3-(methylamino)propoxy]phenyl]-2-oxo-1,8-naphthyridin-3-yl]-3-[2,6-di(propan-2-yl)phenyl]urea (PubChem CID 22105929) has the molecular formula C35H45N5O3 and a molecular weight of 583.78 g/mol. Its IUPAC name is 1-[1-butyl-4-[3-[3-(methylamino)propoxy]phenyl]-2-oxo-1,8-naphthyridin-3-yl]-3-[2,6-di(propan-2-yl)phenyl]urea.
| Compound Name | 1-[1-butyl-4-[3-[3-(methylamino)propoxy]phenyl]-2-oxo-1,8-naphthyridin-3-yl]-3-[2,6-di(propan-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 22105929 |
| Molecular Formula | C35H45N5O3 |
| Molecular Weight | 583.78 g/mol |
| Exact Mass | 583.35 |
| IUPAC Name | 1-[1-butyl-4-[3-[3-(methylamino)propoxy]phenyl]-2-oxo-1,8-naphthyridin-3-yl]-3-[2,6-di(propan-2-yl)phenyl]urea |
| SMILES | CCCCn1c(=O)c(NC(=O)Nc2c(C(C)C)cccc2C(C)C)c(-c2cccc(OCCCNC)c2)c2cccnc21 |
| InChI | InChI=1S/C35H45N5O3/c1-7-8-20-40-33-29(17-11-19-37-33)30(25-13-9-14-26(22-25)43-21-12-18-36-6)32(34(40)41)39-35(42)38-31-27(23(2)3)15-10-16-28(31)24(4)5/h9-11,13-17,19,22-24,36H,7-8,12,18,20-21H2,1-6H3,(H2,38,39,42) |
| InChIKey | PURFAROKPZPCIB-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 97.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.78 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|