C31H37N5O2 — CID 22105990
1-[4-(3-aminophenyl)-1-butyl-2-oxo-1,8-naphthyridin-3-yl]-3-[2,6-di(propan-2-yl)phenyl]urea (PubChem CID 22105990) has the molecular formula C31H37N5O2 and a molecular weight of 511.67 g/mol. Its IUPAC name is 1-[4-(3-aminophenyl)-1-butyl-2-oxo-1,8-naphthyridin-3-yl]-3-[2,6-di(propan-2-yl)phenyl]urea.
| Compound Name | 1-[4-(3-aminophenyl)-1-butyl-2-oxo-1,8-naphthyridin-3-yl]-3-[2,6-di(propan-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 22105990 |
| Molecular Formula | C31H37N5O2 |
| Molecular Weight | 511.67 g/mol |
| Exact Mass | 511.29 |
| IUPAC Name | 1-[4-(3-aminophenyl)-1-butyl-2-oxo-1,8-naphthyridin-3-yl]-3-[2,6-di(propan-2-yl)phenyl]urea |
| SMILES | CCCCn1c(=O)c(NC(=O)Nc2c(C(C)C)cccc2C(C)C)c(-c2cccc(N)c2)c2cccnc21 |
| InChI | InChI=1S/C31H37N5O2/c1-6-7-17-36-29-25(15-10-16-33-29)26(21-11-8-12-22(32)18-21)28(30(36)37)35-31(38)34-27-23(19(2)3)13-9-14-24(27)20(4)5/h8-16,18-20H,6-7,17,32H2,1-5H3,(H2,34,35,38) |
| InChIKey | LPFNGDNHCYMKAZ-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.67 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|