About 1-butyl-3-[1-methyl-2-oxo-4-(3-phenylmethoxyphenyl)-1,8-naphthyridin-3-yl]urea
1-butyl-3-[1-methyl-2-oxo-4-(3-phenylmethoxyphenyl)-1,8-naphthyridin-3-yl]urea (PubChem CID 22106058) has the molecular formula C27H28N4O3
and a molecular weight of 456.55 g/mol. Its IUPAC name is 1-butyl-3-[1-methyl-2-oxo-4-(3-phenylmethoxyphenyl)-1,8-naphthyridin-3-yl]urea.
Molecular Properties
| Compound Name | 1-butyl-3-[1-methyl-2-oxo-4-(3-phenylmethoxyphenyl)-1,8-naphthyridin-3-yl]urea |
| PubChem CID | 22106058 |
| Molecular Formula | C27H28N4O3 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | 1-butyl-3-[1-methyl-2-oxo-4-(3-phenylmethoxyphenyl)-1,8-naphthyridin-3-yl]urea |
| SMILES | CCCCNC(=O)Nc1c(-c2cccc(OCc3ccccc3)c2)c2cccnc2n(C)c1=O |
| InChI | InChI=1S/C27H28N4O3/c1-3-4-15-29-27(33)30-24-23(22-14-9-16-28-25(22)31(2)26(24)32)20-12-8-13-21(17-20)34-18-19-10-6-5-7-11-19/h5-14,16-17H,3-4,15,18H2,1-2H3,(H2,29,30,33) |
| InChIKey | XKHQMFBMVRXBLO-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-3-[1-methyl-2-oxo-4-(3-phenylmethoxyphenyl)-1,8-naphthyridin-3-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-3-[1-methyl-2-oxo-4-(3-phenylmethoxyphenyl)-1,8-naphthyridin-3-yl]urea?
The IUPAC name of 1-butyl-3-[1-methyl-2-oxo-4-(3-phenylmethoxyphenyl)-1,8-naphthyridin-3-yl]urea (CID 22106058) is 1-butyl-3-[1-methyl-2-oxo-4-(3-phenylmethoxyphenyl)-1,8-naphthyridin-3-yl]urea.
What is the SMILES notation for 1-butyl-3-[1-methyl-2-oxo-4-(3-phenylmethoxyphenyl)-1,8-naphthyridin-3-yl]urea?
The canonical SMILES for 1-butyl-3-[1-methyl-2-oxo-4-(3-phenylmethoxyphenyl)-1,8-naphthyridin-3-yl]urea is CCCCNC(=O)Nc1c(-c2cccc(OCc3ccccc3)c2)c2cccnc2n(C)c1=O.
What is the InChIKey of 1-butyl-3-[1-methyl-2-oxo-4-(3-phenylmethoxyphenyl)-1,8-naphthyridin-3-yl]urea?
The InChIKey is XKHQMFBMVRXBLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H28N4O3/c1-3-4-15-29-27(33)30-24-23(22-14-9-16-28-25(22)31(2)26(24)32)20-12-8-13-21(17-20)34-18-19-10-6-5-7-11-19/h5-14,16-17H,3-4,15,18H2,1-2H3,(H2,29,30,33).
What are the key properties of 1-butyl-3-[1-methyl-2-oxo-4-(3-phenylmethoxyphenyl)-1,8-naphthyridin-3-yl]urea?
1-butyl-3-[1-methyl-2-oxo-4-(3-phenylmethoxyphenyl)-1,8-naphthyridin-3-yl]urea has a molecular weight of 456.55 g/mol, XLogP of 5.10, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-3-[1-methyl-2-oxo-4-(3-phenylmethoxyphenyl)-1,8-naphthyridin-3-yl]urea is sourced from PubChem (CID 22106058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).