About 5-[2-[2-[2-(3,4-difluorophenyl)ethyl]-4-fluorophenoxy]ethyl]-1-methylpyrrolidin-3-ol
5-[2-[2-[2-(3,4-difluorophenyl)ethyl]-4-fluorophenoxy]ethyl]-1-methylpyrrolidin-3-ol (PubChem CID 22106902) has the molecular formula C21H24F3NO2
and a molecular weight of 379.42 g/mol. Its IUPAC name is 5-[2-[2-[2-(3,4-difluorophenyl)ethyl]-4-fluorophenoxy]ethyl]-1-methylpyrrolidin-3-ol.
Molecular Properties
| Compound Name | 5-[2-[2-[2-(3,4-difluorophenyl)ethyl]-4-fluorophenoxy]ethyl]-1-methylpyrrolidin-3-ol |
| PubChem CID | 22106902 |
| Molecular Formula | C21H24F3NO2 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 5-[2-[2-[2-(3,4-difluorophenyl)ethyl]-4-fluorophenoxy]ethyl]-1-methylpyrrolidin-3-ol |
| SMILES | CN1CC(O)CC1CCOc1ccc(F)cc1CCc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C21H24F3NO2/c1-25-13-18(26)12-17(25)8-9-27-21-7-5-16(22)11-15(21)4-2-14-3-6-19(23)20(24)10-14/h3,5-7,10-11,17-18,26H,2,4,8-9,12-13H2,1H3 |
| InChIKey | AQXQQWXRQSCCRO-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[2-[2-[2-(3,4-difluorophenyl)ethyl]-4-fluorophenoxy]ethyl]-1-methylpyrrolidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-[2-[2-(3,4-difluorophenyl)ethyl]-4-fluorophenoxy]ethyl]-1-methylpyrrolidin-3-ol?
The IUPAC name of 5-[2-[2-[2-(3,4-difluorophenyl)ethyl]-4-fluorophenoxy]ethyl]-1-methylpyrrolidin-3-ol (CID 22106902) is 5-[2-[2-[2-(3,4-difluorophenyl)ethyl]-4-fluorophenoxy]ethyl]-1-methylpyrrolidin-3-ol.
What is the SMILES notation for 5-[2-[2-[2-(3,4-difluorophenyl)ethyl]-4-fluorophenoxy]ethyl]-1-methylpyrrolidin-3-ol?
The canonical SMILES for 5-[2-[2-[2-(3,4-difluorophenyl)ethyl]-4-fluorophenoxy]ethyl]-1-methylpyrrolidin-3-ol is CN1CC(O)CC1CCOc1ccc(F)cc1CCc1ccc(F)c(F)c1.
What is the InChIKey of 5-[2-[2-[2-(3,4-difluorophenyl)ethyl]-4-fluorophenoxy]ethyl]-1-methylpyrrolidin-3-ol?
The InChIKey is AQXQQWXRQSCCRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24F3NO2/c1-25-13-18(26)12-17(25)8-9-27-21-7-5-16(22)11-15(21)4-2-14-3-6-19(23)20(24)10-14/h3,5-7,10-11,17-18,26H,2,4,8-9,12-13H2,1H3.
What are the key properties of 5-[2-[2-[2-(3,4-difluorophenyl)ethyl]-4-fluorophenoxy]ethyl]-1-methylpyrrolidin-3-ol?
5-[2-[2-[2-(3,4-difluorophenyl)ethyl]-4-fluorophenoxy]ethyl]-1-methylpyrrolidin-3-ol has a molecular weight of 379.42 g/mol, XLogP of 3.72, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-[2-[2-(3,4-difluorophenyl)ethyl]-4-fluorophenoxy]ethyl]-1-methylpyrrolidin-3-ol is sourced from PubChem (CID 22106902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).