C19H10F6O8 — CID 22107569
3-[2-(2,3-dicarboxy-4,5,6-trifluorophenyl)propan-2-yl]-4,5,6-trifluorophthalic acid (PubChem CID 22107569) has the molecular formula C19H10F6O8 and a molecular weight of 480.27 g/mol. Its IUPAC name is 3-[2-(2,3-dicarboxy-4,5,6-trifluorophenyl)propan-2-yl]-4,5,6-trifluorophthalic acid.
| Compound Name | 3-[2-(2,3-dicarboxy-4,5,6-trifluorophenyl)propan-2-yl]-4,5,6-trifluorophthalic acid |
|---|---|
| PubChem CID | 22107569 |
| Molecular Formula | C19H10F6O8 |
| Molecular Weight | 480.27 g/mol |
| Exact Mass | 480.03 |
| IUPAC Name | 3-[2-(2,3-dicarboxy-4,5,6-trifluorophenyl)propan-2-yl]-4,5,6-trifluorophthalic acid |
| SMILES | CC(C)(c1c(F)c(F)c(F)c(C(=O)O)c1C(=O)O)c1c(F)c(F)c(F)c(C(=O)O)c1C(=O)O |
| InChI | InChI=1S/C19H10F6O8/c1-19(2,7-3(15(26)27)5(17(30)31)9(20)13(24)11(7)22)8-4(16(28)29)6(18(32)33)10(21)14(25)12(8)23/h1-2H3,(H,26,27)(H,28,29)(H,30,31)(H,32,33) |
| InChIKey | MMFBURLARZHJKF-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.27 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|