About nitrooxy(oxido)azanium
nitrooxy(oxido)azanium (PubChem CID 22107609) has the molecular formula H2N2O4
and a molecular weight of 94.03 g/mol. Its IUPAC name is nitrooxy(oxido)azanium.
Molecular Properties
| Compound Name | nitrooxy(oxido)azanium |
| PubChem CID | 22107609 |
| Molecular Formula | H2N2O4 |
| Molecular Weight | 94.03 g/mol |
| Exact Mass | 94.00 |
| IUPAC Name | nitrooxy(oxido)azanium |
| SMILES | O=[N+]([O-])O[NH2+][O-] |
| InChI | InChI=1S/H2N2O4/c3-1-6-2(4)5/h1H2 |
| InChIKey | XQITZJQZRNIFCU-UHFFFAOYSA-N |
| XLogP | -1.83 |
| TPSA | 92.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 94.03 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze nitrooxy(oxido)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nitrooxy(oxido)azanium?
The IUPAC name of nitrooxy(oxido)azanium (CID 22107609) is nitrooxy(oxido)azanium.
What is the SMILES notation for nitrooxy(oxido)azanium?
The canonical SMILES for nitrooxy(oxido)azanium is O=[N+]([O-])O[NH2+][O-].
What is the InChIKey of nitrooxy(oxido)azanium?
The InChIKey is XQITZJQZRNIFCU-UHFFFAOYSA-N. The full InChI is InChI=1S/H2N2O4/c3-1-6-2(4)5/h1H2.
What are the key properties of nitrooxy(oxido)azanium?
nitrooxy(oxido)azanium has a molecular weight of 94.03 g/mol, XLogP of -1.83, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for nitrooxy(oxido)azanium is sourced from PubChem (CID 22107609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).