About 4-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]piperazin-2-one
4-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]piperazin-2-one (PubChem CID 22107793) has the molecular formula C12H13ClN4O
and a molecular weight of 264.72 g/mol. Its IUPAC name is 4-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]piperazin-2-one.
Molecular Properties
| Compound Name | 4-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]piperazin-2-one |
| PubChem CID | 22107793 |
| Molecular Formula | C12H13ClN4O |
| Molecular Weight | 264.72 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 4-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]piperazin-2-one |
| SMILES | O=C1CN(Cc2cn3cc(Cl)ccc3n2)CCN1 |
| InChI | InChI=1S/C12H13ClN4O/c13-9-1-2-11-15-10(7-17(11)5-9)6-16-4-3-14-12(18)8-16/h1-2,5,7H,3-4,6,8H2,(H,14,18) |
| InChIKey | IFZLRXSYVYXNAB-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.72 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]piperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]piperazin-2-one?
The IUPAC name of 4-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]piperazin-2-one (CID 22107793) is 4-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]piperazin-2-one.
What is the SMILES notation for 4-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]piperazin-2-one?
The canonical SMILES for 4-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]piperazin-2-one is O=C1CN(Cc2cn3cc(Cl)ccc3n2)CCN1.
What is the InChIKey of 4-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]piperazin-2-one?
The InChIKey is IFZLRXSYVYXNAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13ClN4O/c13-9-1-2-11-15-10(7-17(11)5-9)6-16-4-3-14-12(18)8-16/h1-2,5,7H,3-4,6,8H2,(H,14,18).
What are the key properties of 4-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]piperazin-2-one?
4-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]piperazin-2-one has a molecular weight of 264.72 g/mol, XLogP of 0.92, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]piperazin-2-one is sourced from PubChem (CID 22107793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).