C15H12ClNO5S — CID 22107811
[2-(3-acetamido-4-hydroxyphenyl)-2-oxoethyl] 5-chlorothiophene-2-carboxylate (PubChem CID 22107811) has the molecular formula C15H12ClNO5S and a molecular weight of 353.78 g/mol. Its IUPAC name is [2-(3-acetamido-4-hydroxyphenyl)-2-oxoethyl] 5-chlorothiophene-2-carboxylate.
| Compound Name | [2-(3-acetamido-4-hydroxyphenyl)-2-oxoethyl] 5-chlorothiophene-2-carboxylate |
|---|---|
| PubChem CID | 22107811 |
| Molecular Formula | C15H12ClNO5S |
| Molecular Weight | 353.78 g/mol |
| Exact Mass | 353.01 |
| IUPAC Name | [2-(3-acetamido-4-hydroxyphenyl)-2-oxoethyl] 5-chlorothiophene-2-carboxylate |
| SMILES | CC(=O)Nc1cc(C(=O)COC(=O)c2ccc(Cl)s2)ccc1O |
| InChI | InChI=1S/C15H12ClNO5S/c1-8(18)17-10-6-9(2-3-11(10)19)12(20)7-22-15(21)13-4-5-14(16)23-13/h2-6,19H,7H2,1H3,(H,17,18) |
| InChIKey | ZVUQCIVGPJQVCB-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.78 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|