About 3-(3,4-dipropoxyphenyl)-2-sulfanylidene-1H-quinazolin-4-one
3-(3,4-dipropoxyphenyl)-2-sulfanylidene-1H-quinazolin-4-one (PubChem CID 22108087) has the molecular formula C20H22N2O3S
and a molecular weight of 370.47 g/mol. Its IUPAC name is 3-(3,4-dipropoxyphenyl)-2-sulfanylidene-1H-quinazolin-4-one.
Molecular Properties
| Compound Name | 3-(3,4-dipropoxyphenyl)-2-sulfanylidene-1H-quinazolin-4-one |
| PubChem CID | 22108087 |
| Molecular Formula | C20H22N2O3S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 3-(3,4-dipropoxyphenyl)-2-sulfanylidene-1H-quinazolin-4-one |
| SMILES | CCCOc1ccc(-n2c(=S)[nH]c3ccccc3c2=O)cc1OCCC |
| InChI | InChI=1S/C20H22N2O3S/c1-3-11-24-17-10-9-14(13-18(17)25-12-4-2)22-19(23)15-7-5-6-8-16(15)21-20(22)26/h5-10,13H,3-4,11-12H2,1-2H3,(H,21,26) |
| InChIKey | MHPQCLBBZAFUSD-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,4-dipropoxyphenyl)-2-sulfanylidene-1H-quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dipropoxyphenyl)-2-sulfanylidene-1H-quinazolin-4-one?
The IUPAC name of 3-(3,4-dipropoxyphenyl)-2-sulfanylidene-1H-quinazolin-4-one (CID 22108087) is 3-(3,4-dipropoxyphenyl)-2-sulfanylidene-1H-quinazolin-4-one.
What is the SMILES notation for 3-(3,4-dipropoxyphenyl)-2-sulfanylidene-1H-quinazolin-4-one?
The canonical SMILES for 3-(3,4-dipropoxyphenyl)-2-sulfanylidene-1H-quinazolin-4-one is CCCOc1ccc(-n2c(=S)[nH]c3ccccc3c2=O)cc1OCCC.
What is the InChIKey of 3-(3,4-dipropoxyphenyl)-2-sulfanylidene-1H-quinazolin-4-one?
The InChIKey is MHPQCLBBZAFUSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N2O3S/c1-3-11-24-17-10-9-14(13-18(17)25-12-4-2)22-19(23)15-7-5-6-8-16(15)21-20(22)26/h5-10,13H,3-4,11-12H2,1-2H3,(H,21,26).
What are the key properties of 3-(3,4-dipropoxyphenyl)-2-sulfanylidene-1H-quinazolin-4-one?
3-(3,4-dipropoxyphenyl)-2-sulfanylidene-1H-quinazolin-4-one has a molecular weight of 370.47 g/mol, XLogP of 4.63, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dipropoxyphenyl)-2-sulfanylidene-1H-quinazolin-4-one is sourced from PubChem (CID 22108087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).