C24H22ClN3O5 — CID 22108267
N-[2-[2-[4-[(4-chlorophenoxy)methyl]benzoyl]hydrazinyl]-2-oxoethyl]-2-phenoxyacetamide (PubChem CID 22108267) has the molecular formula C24H22ClN3O5 and a molecular weight of 467.91 g/mol. Its IUPAC name is N-[2-[2-[4-[(4-chlorophenoxy)methyl]benzoyl]hydrazinyl]-2-oxoethyl]-2-phenoxyacetamide.
| Compound Name | N-[2-[2-[4-[(4-chlorophenoxy)methyl]benzoyl]hydrazinyl]-2-oxoethyl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 22108267 |
| Molecular Formula | C24H22ClN3O5 |
| Molecular Weight | 467.91 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | N-[2-[2-[4-[(4-chlorophenoxy)methyl]benzoyl]hydrazinyl]-2-oxoethyl]-2-phenoxyacetamide |
| SMILES | O=C(COc1ccccc1)NCC(=O)NNC(=O)c1ccc(COc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C24H22ClN3O5/c25-19-10-12-21(13-11-19)32-15-17-6-8-18(9-7-17)24(31)28-27-22(29)14-26-23(30)16-33-20-4-2-1-3-5-20/h1-13H,14-16H2,(H,26,30)(H,27,29)(H,28,31) |
| InChIKey | IBCSABUAVUQRMQ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.91 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|