C22H28N2O — CID 22109708
N,3,4-trimethyl-N-[(2-piperidin-1-ylphenyl)methyl]benzamide (PubChem CID 22109708) has the molecular formula C22H28N2O and a molecular weight of 336.48 g/mol. Its IUPAC name is N,3,4-trimethyl-N-[(2-piperidin-1-ylphenyl)methyl]benzamide.
| Compound Name | N,3,4-trimethyl-N-[(2-piperidin-1-ylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 22109708 |
| Molecular Formula | C22H28N2O |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | N,3,4-trimethyl-N-[(2-piperidin-1-ylphenyl)methyl]benzamide |
| SMILES | Cc1ccc(C(=O)N(C)Cc2ccccc2N2CCCCC2)cc1C |
| InChI | InChI=1S/C22H28N2O/c1-17-11-12-19(15-18(17)2)22(25)23(3)16-20-9-5-6-10-21(20)24-13-7-4-8-14-24/h5-6,9-12,15H,4,7-8,13-14,16H2,1-3H3 |
| InChIKey | YPUWGMGQHVVYPI-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |