C21H21N3O2 — CID 22110781
4-(3-benzyl-1,2,4-oxadiazol-5-yl)-1-(1-phenylethyl)pyrrolidin-2-one (PubChem CID 22110781) has the molecular formula C21H21N3O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is 4-(3-benzyl-1,2,4-oxadiazol-5-yl)-1-(1-phenylethyl)pyrrolidin-2-one.
| Compound Name | 4-(3-benzyl-1,2,4-oxadiazol-5-yl)-1-(1-phenylethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 22110781 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 4-(3-benzyl-1,2,4-oxadiazol-5-yl)-1-(1-phenylethyl)pyrrolidin-2-one |
| SMILES | CC(c1ccccc1)N1CC(c2nc(Cc3ccccc3)no2)CC1=O |
| InChI | InChI=1S/C21H21N3O2/c1-15(17-10-6-3-7-11-17)24-14-18(13-20(24)25)21-22-19(23-26-21)12-16-8-4-2-5-9-16/h2-11,15,18H,12-14H2,1H3 |
| InChIKey | IGGCPUPUCZSJAR-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |