C19H28N2O3 — CID 22110964
1-[(5-amino-2,4,6,7-tetramethyl-3H-1-benzofuran-2-yl)methyl]piperidine-4-carboxylic acid (PubChem CID 22110964) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is 1-[(5-amino-2,4,6,7-tetramethyl-3H-1-benzofuran-2-yl)methyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[(5-amino-2,4,6,7-tetramethyl-3H-1-benzofuran-2-yl)methyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 22110964 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | 1-[(5-amino-2,4,6,7-tetramethyl-3H-1-benzofuran-2-yl)methyl]piperidine-4-carboxylic acid |
| SMILES | Cc1c(C)c2c(c(C)c1N)CC(C)(CN1CCC(C(=O)O)CC1)O2 |
| InChI | InChI=1S/C19H28N2O3/c1-11-12(2)17-15(13(3)16(11)20)9-19(4,24-17)10-21-7-5-14(6-8-21)18(22)23/h14H,5-10,20H2,1-4H3,(H,22,23) |
| InChIKey | FGLOQJLDUBBZTF-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|