C34H43N3O2 — CID 22111004
1-[(5-amino-2,4,6,7-tetramethyl-3H-1-benzofuran-2-yl)methyl]-N-(3,3-diphenylpropyl)piperidine-4-carboxamide (PubChem CID 22111004) has the molecular formula C34H43N3O2 and a molecular weight of 525.74 g/mol. Its IUPAC name is 1-[(5-amino-2,4,6,7-tetramethyl-3H-1-benzofuran-2-yl)methyl]-N-(3,3-diphenylpropyl)piperidine-4-carboxamide.
| Compound Name | 1-[(5-amino-2,4,6,7-tetramethyl-3H-1-benzofuran-2-yl)methyl]-N-(3,3-diphenylpropyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 22111004 |
| Molecular Formula | C34H43N3O2 |
| Molecular Weight | 525.74 g/mol |
| Exact Mass | 525.34 |
| IUPAC Name | 1-[(5-amino-2,4,6,7-tetramethyl-3H-1-benzofuran-2-yl)methyl]-N-(3,3-diphenylpropyl)piperidine-4-carboxamide |
| SMILES | Cc1c(C)c2c(c(C)c1N)CC(C)(CN1CCC(C(=O)NCCC(c3ccccc3)c3ccccc3)CC1)O2 |
| InChI | InChI=1S/C34H43N3O2/c1-23-24(2)32-30(25(3)31(23)35)21-34(4,39-32)22-37-19-16-28(17-20-37)33(38)36-18-15-29(26-11-7-5-8-12-26)27-13-9-6-10-14-27/h5-14,28-29H,15-22,35H2,1-4H3,(H,36,38) |
| InChIKey | SLQZVKYEENFHHM-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.74 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|