About 2-amino-1-methoxyethanol
2-amino-1-methoxyethanol (PubChem CID 22111431) has the molecular formula C3H9NO2
and a molecular weight of 91.11 g/mol. Its IUPAC name is 2-amino-1-methoxyethanol.
Molecular Properties
| Compound Name | 2-amino-1-methoxyethanol |
| PubChem CID | 22111431 |
| Molecular Formula | C3H9NO2 |
| Molecular Weight | 91.11 g/mol |
| Exact Mass | 91.06 |
| IUPAC Name | 2-amino-1-methoxyethanol |
| SMILES | COC(O)CN |
| InChI | InChI=1S/C3H9NO2/c1-6-3(5)2-4/h3,5H,2,4H2,1H3 |
| InChIKey | KZQJDPGJTFNOGX-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 91.11 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-1-methoxyethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-methoxyethanol?
The IUPAC name of 2-amino-1-methoxyethanol (CID 22111431) is 2-amino-1-methoxyethanol.
What is the SMILES notation for 2-amino-1-methoxyethanol?
The canonical SMILES for 2-amino-1-methoxyethanol is COC(O)CN.
What is the InChIKey of 2-amino-1-methoxyethanol?
The InChIKey is KZQJDPGJTFNOGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9NO2/c1-6-3(5)2-4/h3,5H,2,4H2,1H3.
What are the key properties of 2-amino-1-methoxyethanol?
2-amino-1-methoxyethanol has a molecular weight of 91.11 g/mol, XLogP of -1.09, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-methoxyethanol is sourced from PubChem (CID 22111431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).