About 5-chloro-N,N-dipropylpentane-1-sulfonamide
5-chloro-N,N-dipropylpentane-1-sulfonamide (PubChem CID 22111563) has the molecular formula C11H24ClNO2S
and a molecular weight of 269.84 g/mol. Its IUPAC name is 5-chloro-N,N-dipropylpentane-1-sulfonamide.
Molecular Properties
| Compound Name | 5-chloro-N,N-dipropylpentane-1-sulfonamide |
| PubChem CID | 22111563 |
| Molecular Formula | C11H24ClNO2S |
| Molecular Weight | 269.84 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 5-chloro-N,N-dipropylpentane-1-sulfonamide |
| SMILES | CCCN(CCC)S(=O)(=O)CCCCCCl |
| InChI | InChI=1S/C11H24ClNO2S/c1-3-9-13(10-4-2)16(14,15)11-7-5-6-8-12/h3-11H2,1-2H3 |
| InChIKey | LNOGBDJXRZVZTP-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.84 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-N,N-dipropylpentane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-N,N-dipropylpentane-1-sulfonamide?
The IUPAC name of 5-chloro-N,N-dipropylpentane-1-sulfonamide (CID 22111563) is 5-chloro-N,N-dipropylpentane-1-sulfonamide.
What is the SMILES notation for 5-chloro-N,N-dipropylpentane-1-sulfonamide?
The canonical SMILES for 5-chloro-N,N-dipropylpentane-1-sulfonamide is CCCN(CCC)S(=O)(=O)CCCCCCl.
What is the InChIKey of 5-chloro-N,N-dipropylpentane-1-sulfonamide?
The InChIKey is LNOGBDJXRZVZTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24ClNO2S/c1-3-9-13(10-4-2)16(14,15)11-7-5-6-8-12/h3-11H2,1-2H3.
What are the key properties of 5-chloro-N,N-dipropylpentane-1-sulfonamide?
5-chloro-N,N-dipropylpentane-1-sulfonamide has a molecular weight of 269.84 g/mol, XLogP of 2.85, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-N,N-dipropylpentane-1-sulfonamide is sourced from PubChem (CID 22111563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).