C29H24N4OS2 — CID 22111926
2-[5-[1-(2-hexoxyphenyl)-5-thiophen-2-ylpyrrol-2-yl]thiophen-2-yl]ethene-1,1,2-tricarbonitrile (PubChem CID 22111926) has the molecular formula C29H24N4OS2 and a molecular weight of 508.67 g/mol. Its IUPAC name is 2-[5-[1-(2-hexoxyphenyl)-5-thiophen-2-ylpyrrol-2-yl]thiophen-2-yl]ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-[5-[1-(2-hexoxyphenyl)-5-thiophen-2-ylpyrrol-2-yl]thiophen-2-yl]ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 22111926 |
| Molecular Formula | C29H24N4OS2 |
| Molecular Weight | 508.67 g/mol |
| Exact Mass | 508.14 |
| IUPAC Name | 2-[5-[1-(2-hexoxyphenyl)-5-thiophen-2-ylpyrrol-2-yl]thiophen-2-yl]ethene-1,1,2-tricarbonitrile |
| SMILES | CCCCCCOc1ccccc1-n1c(-c2cccs2)ccc1-c1ccc(C(C#N)=C(C#N)C#N)s1 |
| InChI | InChI=1S/C29H24N4OS2/c1-2-3-4-7-16-34-26-10-6-5-9-23(26)33-24(28-11-8-17-35-28)12-13-25(33)29-15-14-27(36-29)22(20-32)21(18-30)19-31/h5-6,8-15,17H,2-4,7,16H2,1H3 |
| InChIKey | OSMOZNIZHAFIKY-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 85.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.67 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|