About CID 22112643
CID 22112643 (PubChem CID 22112643) has the molecular formula H3NO2S
and a molecular weight of 81.10 g/mol.
Molecular Properties
| Compound Name | CID 22112643 |
| PubChem CID | 22112643 |
| Molecular Formula | H3NO2S |
| Molecular Weight | 81.10 g/mol |
| Exact Mass | 80.99 |
| IUPAC Name | — |
| SMILES | NS(=O)[O-].[H+] |
| InChI | InChI=1S/H3NO2S/c1-4(2)3/h1H2,(H,2,3) |
| InChIKey | JXUFISIHEZOBPI-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 4 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 81.10 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze CID 22112643 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 22112643?
The IUPAC name of CID 22112643 (CID 22112643) is not available.
What is the SMILES notation for CID 22112643?
The canonical SMILES for CID 22112643 is NS(=O)[O-].[H+].
What is the InChIKey of CID 22112643?
The InChIKey is JXUFISIHEZOBPI-UHFFFAOYSA-N. The full InChI is InChI=1S/H3NO2S/c1-4(2)3/h1H2,(H,2,3).
What are the key properties of CID 22112643?
CID 22112643 has a molecular weight of 81.10 g/mol, XLogP of -1.15, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 22112643 is sourced from PubChem (CID 22112643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).