About 2-ethyl-7-methoxyfuro[2,3-c]pyridine
2-ethyl-7-methoxyfuro[2,3-c]pyridine (PubChem CID 22112779) has the molecular formula C10H11NO2
and a molecular weight of 177.20 g/mol. Its IUPAC name is 2-ethyl-7-methoxyfuro[2,3-c]pyridine.
Molecular Properties
| Compound Name | 2-ethyl-7-methoxyfuro[2,3-c]pyridine |
| PubChem CID | 22112779 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | 2-ethyl-7-methoxyfuro[2,3-c]pyridine |
| SMILES | CCc1cc2ccnc(OC)c2o1 |
| InChI | InChI=1S/C10H11NO2/c1-3-8-6-7-4-5-11-10(12-2)9(7)13-8/h4-6H,3H2,1-2H3 |
| InChIKey | AWFFWTDUPVHHBB-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethyl-7-methoxyfuro[2,3-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-7-methoxyfuro[2,3-c]pyridine?
The IUPAC name of 2-ethyl-7-methoxyfuro[2,3-c]pyridine (CID 22112779) is 2-ethyl-7-methoxyfuro[2,3-c]pyridine.
What is the SMILES notation for 2-ethyl-7-methoxyfuro[2,3-c]pyridine?
The canonical SMILES for 2-ethyl-7-methoxyfuro[2,3-c]pyridine is CCc1cc2ccnc(OC)c2o1.
What is the InChIKey of 2-ethyl-7-methoxyfuro[2,3-c]pyridine?
The InChIKey is AWFFWTDUPVHHBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO2/c1-3-8-6-7-4-5-11-10(12-2)9(7)13-8/h4-6H,3H2,1-2H3.
What are the key properties of 2-ethyl-7-methoxyfuro[2,3-c]pyridine?
2-ethyl-7-methoxyfuro[2,3-c]pyridine has a molecular weight of 177.20 g/mol, XLogP of 2.40, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-7-methoxyfuro[2,3-c]pyridine is sourced from PubChem (CID 22112779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).