About N-[3-(bromomethyl)-2,4-dichlorophenyl]-2-(1,3-dioxoisoindol-2-yl)-N-methylacetamide
N-[3-(bromomethyl)-2,4-dichlorophenyl]-2-(1,3-dioxoisoindol-2-yl)-N-methylacetamide (PubChem CID 22113338) has the molecular formula C18H13BrCl2N2O3
and a molecular weight of 456.12 g/mol. Its IUPAC name is N-[3-(bromomethyl)-2,4-dichlorophenyl]-2-(1,3-dioxoisoindol-2-yl)-N-methylacetamide.
Molecular Properties
| Compound Name | N-[3-(bromomethyl)-2,4-dichlorophenyl]-2-(1,3-dioxoisoindol-2-yl)-N-methylacetamide |
| PubChem CID | 22113338 |
| Molecular Formula | C18H13BrCl2N2O3 |
| Molecular Weight | 456.12 g/mol |
| Exact Mass | 453.95 |
| IUPAC Name | N-[3-(bromomethyl)-2,4-dichlorophenyl]-2-(1,3-dioxoisoindol-2-yl)-N-methylacetamide |
| SMILES | CN(C(=O)CN1C(=O)c2ccccc2C1=O)c1ccc(Cl)c(CBr)c1Cl |
| InChI | InChI=1S/C18H13BrCl2N2O3/c1-22(14-7-6-13(20)12(8-19)16(14)21)15(24)9-23-17(25)10-4-2-3-5-11(10)18(23)26/h2-7H,8-9H2,1H3 |
| InChIKey | RANKJCROTQIJTK-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 456.12 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(bromomethyl)-2,4-dichlorophenyl]-2-(1,3-dioxoisoindol-2-yl)-N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(bromomethyl)-2,4-dichlorophenyl]-2-(1,3-dioxoisoindol-2-yl)-N-methylacetamide?
The IUPAC name of N-[3-(bromomethyl)-2,4-dichlorophenyl]-2-(1,3-dioxoisoindol-2-yl)-N-methylacetamide (CID 22113338) is N-[3-(bromomethyl)-2,4-dichlorophenyl]-2-(1,3-dioxoisoindol-2-yl)-N-methylacetamide.
What is the SMILES notation for N-[3-(bromomethyl)-2,4-dichlorophenyl]-2-(1,3-dioxoisoindol-2-yl)-N-methylacetamide?
The canonical SMILES for N-[3-(bromomethyl)-2,4-dichlorophenyl]-2-(1,3-dioxoisoindol-2-yl)-N-methylacetamide is CN(C(=O)CN1C(=O)c2ccccc2C1=O)c1ccc(Cl)c(CBr)c1Cl.
What is the InChIKey of N-[3-(bromomethyl)-2,4-dichlorophenyl]-2-(1,3-dioxoisoindol-2-yl)-N-methylacetamide?
The InChIKey is RANKJCROTQIJTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13BrCl2N2O3/c1-22(14-7-6-13(20)12(8-19)16(14)21)15(24)9-23-17(25)10-4-2-3-5-11(10)18(23)26/h2-7H,8-9H2,1H3.
What are the key properties of N-[3-(bromomethyl)-2,4-dichlorophenyl]-2-(1,3-dioxoisoindol-2-yl)-N-methylacetamide?
N-[3-(bromomethyl)-2,4-dichlorophenyl]-2-(1,3-dioxoisoindol-2-yl)-N-methylacetamide has a molecular weight of 456.12 g/mol, XLogP of 4.15, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(bromomethyl)-2,4-dichlorophenyl]-2-(1,3-dioxoisoindol-2-yl)-N-methylacetamide is sourced from PubChem (CID 22113338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).