About 1-(13-methyl-5,9,13-triaza-1-azanidacyclohexadec-2-yl)ethanone;titanium(4+);trichloride
1-(13-methyl-5,9,13-triaza-1-azanidacyclohexadec-2-yl)ethanone;titanium(4+);trichloride (PubChem CID 22113541) has the molecular formula C15H31Cl3N4OTi
and a molecular weight of 437.67 g/mol. Its IUPAC name is 1-(13-methyl-5,9,13-triaza-1-azanidacyclohexadec-2-yl)ethanone;titanium(4+);trichloride.
Molecular Properties
| Compound Name | 1-(13-methyl-5,9,13-triaza-1-azanidacyclohexadec-2-yl)ethanone;titanium(4+);trichloride |
| PubChem CID | 22113541 |
| Molecular Formula | C15H31Cl3N4OTi |
| Molecular Weight | 437.67 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | 1-(13-methyl-5,9,13-triaza-1-azanidacyclohexadec-2-yl)ethanone;titanium(4+);trichloride |
| SMILES | CC(=O)C1CCNCCCNCCCN(C)CCC[N-]1.[Cl-].[Cl-].[Cl-].[Ti+4] |
| InChI | InChI=1S/C15H31N4O.3ClH.Ti/c1-14(20)15-6-11-17-8-3-7-16-9-4-12-19(2)13-5-10-18-15;;;;/h15-17H,3-13H2,1-2H3;3*1H;/q-1;;;;+4/p-3 |
| InChIKey | LPFSWTGDHIGJAE-UHFFFAOYSA-K |
| XLogP | -7.99 |
| TPSA | 58.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.67 |
| LogP ≤ 5 | -7.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(13-methyl-5,9,13-triaza-1-azanidacyclohexadec-2-yl)ethanone;titanium(4+);trichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(13-methyl-5,9,13-triaza-1-azanidacyclohexadec-2-yl)ethanone;titanium(4+);trichloride?
The IUPAC name of 1-(13-methyl-5,9,13-triaza-1-azanidacyclohexadec-2-yl)ethanone;titanium(4+);trichloride (CID 22113541) is 1-(13-methyl-5,9,13-triaza-1-azanidacyclohexadec-2-yl)ethanone;titanium(4+);trichloride.
What is the SMILES notation for 1-(13-methyl-5,9,13-triaza-1-azanidacyclohexadec-2-yl)ethanone;titanium(4+);trichloride?
The canonical SMILES for 1-(13-methyl-5,9,13-triaza-1-azanidacyclohexadec-2-yl)ethanone;titanium(4+);trichloride is CC(=O)C1CCNCCCNCCCN(C)CCC[N-]1.[Cl-].[Cl-].[Cl-].[Ti+4].
What is the InChIKey of 1-(13-methyl-5,9,13-triaza-1-azanidacyclohexadec-2-yl)ethanone;titanium(4+);trichloride?
The InChIKey is LPFSWTGDHIGJAE-UHFFFAOYSA-K. The full InChI is InChI=1S/C15H31N4O.3ClH.Ti/c1-14(20)15-6-11-17-8-3-7-16-9-4-12-19(2)13-5-10-18-15;;;;/h15-17H,3-13H2,1-2H3;3*1H;/q-1;;;;+4/p-3.
What are the key properties of 1-(13-methyl-5,9,13-triaza-1-azanidacyclohexadec-2-yl)ethanone;titanium(4+);trichloride?
1-(13-methyl-5,9,13-triaza-1-azanidacyclohexadec-2-yl)ethanone;titanium(4+);trichloride has a molecular weight of 437.67 g/mol, XLogP of -7.99, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(13-methyl-5,9,13-triaza-1-azanidacyclohexadec-2-yl)ethanone;titanium(4+);trichloride is sourced from PubChem (CID 22113541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).