About 1,3-dimethylpiperazin-4-ide;titanium(4+);trichloride
1,3-dimethylpiperazin-4-ide;titanium(4+);trichloride (PubChem CID 22113646) has the molecular formula C6H13Cl3N2Ti
and a molecular weight of 267.41 g/mol. Its IUPAC name is 1,3-dimethylpiperazin-4-ide;titanium(4+);trichloride.
Molecular Properties
| Compound Name | 1,3-dimethylpiperazin-4-ide;titanium(4+);trichloride |
| PubChem CID | 22113646 |
| Molecular Formula | C6H13Cl3N2Ti |
| Molecular Weight | 267.41 g/mol |
| Exact Mass | 265.96 |
| IUPAC Name | 1,3-dimethylpiperazin-4-ide;titanium(4+);trichloride |
| SMILES | CC1CN(C)CC[N-]1.[Cl-].[Cl-].[Cl-].[Ti+4] |
| InChI | InChI=1S/C6H13N2.3ClH.Ti/c1-6-5-8(2)4-3-7-6;;;;/h6H,3-5H2,1-2H3;3*1H;/q-1;;;;+4/p-3 |
| InChIKey | LITAGIRXJPOJKF-UHFFFAOYSA-K |
| XLogP | -8.30 |
| TPSA | 17.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.41 |
| LogP ≤ 5 | -8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,3-dimethylpiperazin-4-ide;titanium(4+);trichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethylpiperazin-4-ide;titanium(4+);trichloride?
The IUPAC name of 1,3-dimethylpiperazin-4-ide;titanium(4+);trichloride (CID 22113646) is 1,3-dimethylpiperazin-4-ide;titanium(4+);trichloride.
What is the SMILES notation for 1,3-dimethylpiperazin-4-ide;titanium(4+);trichloride?
The canonical SMILES for 1,3-dimethylpiperazin-4-ide;titanium(4+);trichloride is CC1CN(C)CC[N-]1.[Cl-].[Cl-].[Cl-].[Ti+4].
What is the InChIKey of 1,3-dimethylpiperazin-4-ide;titanium(4+);trichloride?
The InChIKey is LITAGIRXJPOJKF-UHFFFAOYSA-K. The full InChI is InChI=1S/C6H13N2.3ClH.Ti/c1-6-5-8(2)4-3-7-6;;;;/h6H,3-5H2,1-2H3;3*1H;/q-1;;;;+4/p-3.
What are the key properties of 1,3-dimethylpiperazin-4-ide;titanium(4+);trichloride?
1,3-dimethylpiperazin-4-ide;titanium(4+);trichloride has a molecular weight of 267.41 g/mol, XLogP of -8.30, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethylpiperazin-4-ide;titanium(4+);trichloride is sourced from PubChem (CID 22113646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).