About 1-(9-methyl-5,9-diaza-1-azanidacyclododec-2-yl)ethanone;titanium(3+);dichloride
1-(9-methyl-5,9-diaza-1-azanidacyclododec-2-yl)ethanone;titanium(3+);dichloride (PubChem CID 22113694) has the molecular formula C12H24Cl2N3OTi
and a molecular weight of 345.12 g/mol. Its IUPAC name is 1-(9-methyl-5,9-diaza-1-azanidacyclododec-2-yl)ethanone;titanium(3+);dichloride.
Molecular Properties
| Compound Name | 1-(9-methyl-5,9-diaza-1-azanidacyclododec-2-yl)ethanone;titanium(3+);dichloride |
| PubChem CID | 22113694 |
| Molecular Formula | C12H24Cl2N3OTi |
| Molecular Weight | 345.12 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 1-(9-methyl-5,9-diaza-1-azanidacyclododec-2-yl)ethanone;titanium(3+);dichloride |
| SMILES | CC(=O)C1CCNCCCN(C)CCC[N-]1.[Cl-].[Cl-].[Ti+3] |
| InChI | InChI=1S/C12H24N3O.2ClH.Ti/c1-11(16)12-5-8-13-6-3-9-15(2)10-4-7-14-12;;;/h12-13H,3-10H2,1-2H3;2*1H;/q-1;;;+3/p-2 |
| InChIKey | CLTZFYFUYDUSEA-UHFFFAOYSA-L |
| XLogP | -4.97 |
| TPSA | 46.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.12 |
| LogP ≤ 5 | -4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(9-methyl-5,9-diaza-1-azanidacyclododec-2-yl)ethanone;titanium(3+);dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(9-methyl-5,9-diaza-1-azanidacyclododec-2-yl)ethanone;titanium(3+);dichloride?
The IUPAC name of 1-(9-methyl-5,9-diaza-1-azanidacyclododec-2-yl)ethanone;titanium(3+);dichloride (CID 22113694) is 1-(9-methyl-5,9-diaza-1-azanidacyclododec-2-yl)ethanone;titanium(3+);dichloride.
What is the SMILES notation for 1-(9-methyl-5,9-diaza-1-azanidacyclododec-2-yl)ethanone;titanium(3+);dichloride?
The canonical SMILES for 1-(9-methyl-5,9-diaza-1-azanidacyclododec-2-yl)ethanone;titanium(3+);dichloride is CC(=O)C1CCNCCCN(C)CCC[N-]1.[Cl-].[Cl-].[Ti+3].
What is the InChIKey of 1-(9-methyl-5,9-diaza-1-azanidacyclododec-2-yl)ethanone;titanium(3+);dichloride?
The InChIKey is CLTZFYFUYDUSEA-UHFFFAOYSA-L. The full InChI is InChI=1S/C12H24N3O.2ClH.Ti/c1-11(16)12-5-8-13-6-3-9-15(2)10-4-7-14-12;;;/h12-13H,3-10H2,1-2H3;2*1H;/q-1;;;+3/p-2.
What are the key properties of 1-(9-methyl-5,9-diaza-1-azanidacyclododec-2-yl)ethanone;titanium(3+);dichloride?
1-(9-methyl-5,9-diaza-1-azanidacyclododec-2-yl)ethanone;titanium(3+);dichloride has a molecular weight of 345.12 g/mol, XLogP of -4.97, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(9-methyl-5,9-diaza-1-azanidacyclododec-2-yl)ethanone;titanium(3+);dichloride is sourced from PubChem (CID 22113694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).