C31H16BF22N — CID 22113827
triethylazanium;tris(2,3,4,5,6-pentafluorophenyl)-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]boranuide (PubChem CID 22113827) has the molecular formula C31H16BF22N and a molecular weight of 831.24 g/mol. Its IUPAC name is triethylazanium;tris(2,3,4,5,6-pentafluorophenyl)-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]boranuide.
| Compound Name | triethylazanium;tris(2,3,4,5,6-pentafluorophenyl)-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]boranuide |
|---|---|
| PubChem CID | 22113827 |
| Molecular Formula | C31H16BF22N |
| Molecular Weight | 831.24 g/mol |
| Exact Mass | 831.10 |
| IUPAC Name | triethylazanium;tris(2,3,4,5,6-pentafluorophenyl)-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]boranuide |
| SMILES | CC[NH+](CC)CC.Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(C(F)(F)F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C25BF22.C6H15N/c27-6-1(25(46,47)48)7(28)9(30)2(8(6)29)26(3-10(31)16(37)22(43)17(38)11(3)32,4-12(33)18(39)23(44)19(40)13(4)34)5-14(35)20(41)24(45)21(42)15(5)36;1-4-7(5-2)6-3/h;4-6H2,1-3H3/q-1;/p+1 |
| InChIKey | ISZQJIYZUASBRA-UHFFFAOYSA-O |
| XLogP | 6.66 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.24 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|