About 3-cyclooctylpyran-2-one
3-cyclooctylpyran-2-one (PubChem CID 22113990) has the molecular formula C13H18O2
and a molecular weight of 206.28 g/mol. Its IUPAC name is 3-cyclooctylpyran-2-one.
Molecular Properties
| Compound Name | 3-cyclooctylpyran-2-one |
| PubChem CID | 22113990 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 3-cyclooctylpyran-2-one |
| SMILES | O=c1occcc1C1CCCCCCC1 |
| InChI | InChI=1S/C13H18O2/c14-13-12(9-6-10-15-13)11-7-4-2-1-3-5-8-11/h6,9-11H,1-5,7-8H2 |
| InChIKey | RLEGNEMAZOQPDY-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-cyclooctylpyran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclooctylpyran-2-one?
The IUPAC name of 3-cyclooctylpyran-2-one (CID 22113990) is 3-cyclooctylpyran-2-one.
What is the SMILES notation for 3-cyclooctylpyran-2-one?
The canonical SMILES for 3-cyclooctylpyran-2-one is O=c1occcc1C1CCCCCCC1.
What is the InChIKey of 3-cyclooctylpyran-2-one?
The InChIKey is RLEGNEMAZOQPDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O2/c14-13-12(9-6-10-15-13)11-7-4-2-1-3-5-8-11/h6,9-11H,1-5,7-8H2.
What are the key properties of 3-cyclooctylpyran-2-one?
3-cyclooctylpyran-2-one has a molecular weight of 206.28 g/mol, XLogP of 3.47, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclooctylpyran-2-one is sourced from PubChem (CID 22113990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).