2-(2H-pyran-3-yl)acetic acid

C7H8O3 — CID 22114124

IUPAC2-(2H-pyran-3-yl)acetic acid
SMILESO=C(O)CC1=CC=COC1
InChIInChI=1S/C7H8O3/c8-7(9)4-6-2-1-3-10-5-6/h1-3H,4-5H2,(H,8,9)
InChIKeyIDEIZHMMULZZCF-UHFFFAOYSA-N
MW140.14 g/mol
LogP0.93
Rot. Bonds2

About 2-(2H-pyran-3-yl)acetic acid

2-(2H-pyran-3-yl)acetic acid (PubChem CID 22114124) has the molecular formula C7H8O3 and a molecular weight of 140.14 g/mol. Its IUPAC name is 2-(2H-pyran-3-yl)acetic acid.

Molecular Properties

Compound Name2-(2H-pyran-3-yl)acetic acid
PubChem CID22114124
Molecular FormulaC7H8O3
Molecular Weight140.14 g/mol
Exact Mass140.05
IUPAC Name2-(2H-pyran-3-yl)acetic acid
SMILESO=C(O)CC1=CC=COC1
InChIInChI=1S/C7H8O3/c8-7(9)4-6-2-1-3-10-5-6/h1-3H,4-5H2,(H,8,9)
InChIKeyIDEIZHMMULZZCF-UHFFFAOYSA-N
XLogP0.93
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500140.14
LogP ≤ 50.93
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-(2H-pyran-3-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2H-pyran-3-yl)acetic acid?
The IUPAC name of 2-(2H-pyran-3-yl)acetic acid (CID 22114124) is 2-(2H-pyran-3-yl)acetic acid.
What is the SMILES notation for 2-(2H-pyran-3-yl)acetic acid?
The canonical SMILES for 2-(2H-pyran-3-yl)acetic acid is O=C(O)CC1=CC=COC1.
What is the InChIKey of 2-(2H-pyran-3-yl)acetic acid?
The InChIKey is IDEIZHMMULZZCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O3/c8-7(9)4-6-2-1-3-10-5-6/h1-3H,4-5H2,(H,8,9).
What are the key properties of 2-(2H-pyran-3-yl)acetic acid?
2-(2H-pyran-3-yl)acetic acid has a molecular weight of 140.14 g/mol, XLogP of 0.93, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2H-pyran-3-yl)acetic acid is sourced from PubChem (CID 22114124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).